C27H17BrN4O7 — CID 3946893
N-[2-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-3,5-dinitro-N-phenylbenzamide (PubChem CID 3946893) has the molecular formula C27H17BrN4O7 and a molecular weight of 589.36 g/mol. Its IUPAC name is N-[2-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-3,5-dinitro-N-phenylbenzamide.
| Compound Name | N-[2-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-3,5-dinitro-N-phenylbenzamide |
|---|---|
| PubChem CID | 3946893 |
| Molecular Formula | C27H17BrN4O7 |
| Molecular Weight | 589.36 g/mol |
| Exact Mass | 588.03 |
| IUPAC Name | N-[2-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-3,5-dinitro-N-phenylbenzamide |
| SMILES | O=C1c2cccc3c(Br)ccc(c23)C(=O)N1CCN(C(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C27H17BrN4O7/c28-23-10-9-22-24-20(23)7-4-8-21(24)26(34)30(27(22)35)12-11-29(17-5-2-1-3-6-17)25(33)16-13-18(31(36)37)15-19(14-16)32(38)39/h1-10,13-15H,11-12H2 |
| InChIKey | QHOFHOVWTGLBLC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.36 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|