C27H17FN4O7 — CID 5031547
N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-N-(3-fluorophenyl)-2,4-dinitrobenzamide (PubChem CID 5031547) has the molecular formula C27H17FN4O7 and a molecular weight of 528.45 g/mol. Its IUPAC name is N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-N-(3-fluorophenyl)-2,4-dinitrobenzamide.
| Compound Name | N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-N-(3-fluorophenyl)-2,4-dinitrobenzamide |
|---|---|
| PubChem CID | 5031547 |
| Molecular Formula | C27H17FN4O7 |
| Molecular Weight | 528.45 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]-N-(3-fluorophenyl)-2,4-dinitrobenzamide |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1CCN(C(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1cccc(F)c1 |
| InChI | InChI=1S/C27H17FN4O7/c28-17-6-3-7-18(14-17)29(25(33)20-11-10-19(31(36)37)15-23(20)32(38)39)12-13-30-26(34)21-8-1-4-16-5-2-9-22(24(16)21)27(30)35/h1-11,14-15H,12-13H2 |
| InChIKey | QEBKPIVCJBKJOD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 143.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|