C20H7F5N2O6 — CID 58979922
(2,3,4,5,6-pentafluorophenyl) 2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)acetate (PubChem CID 58979922) has the molecular formula C20H7F5N2O6 and a molecular weight of 466.27 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)acetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)acetate |
|---|---|
| PubChem CID | 58979922 |
| Molecular Formula | C20H7F5N2O6 |
| Molecular Weight | 466.27 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2cccc3cc([N+](=O)[O-])cc(c23)C1=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C20H7F5N2O6/c21-13-14(22)16(24)18(17(25)15(13)23)33-11(28)6-26-19(29)9-3-1-2-7-4-8(27(31)32)5-10(12(7)9)20(26)30/h1-5H,6H2 |
| InChIKey | MCAOVQLNMMCAGB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|