C34H32FN3O5 — CID 4042297
N-[2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)ethyl]-N-(3-fluorophenyl)-3,5-dimethoxybenzamide (PubChem CID 4042297) has the molecular formula C34H32FN3O5 and a molecular weight of 581.64 g/mol. Its IUPAC name is N-[2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)ethyl]-N-(3-fluorophenyl)-3,5-dimethoxybenzamide.
| Compound Name | N-[2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)ethyl]-N-(3-fluorophenyl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 4042297 |
| Molecular Formula | C34H32FN3O5 |
| Molecular Weight | 581.64 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | N-[2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)ethyl]-N-(3-fluorophenyl)-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N(CCN2C(=O)c3cccc4c(N5CCCCC5)ccc(c34)C2=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C34H32FN3O5/c1-42-25-18-22(19-26(21-25)43-2)32(39)37(24-9-6-8-23(35)20-24)16-17-38-33(40)28-11-7-10-27-30(36-14-4-3-5-15-36)13-12-29(31(27)28)34(38)41/h6-13,18-21H,3-5,14-17H2,1-2H3 |
| InChIKey | RCQDJNZWLWJVGZ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.64 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|