C25H24N2O2 — CID 15374734
2-(2-phenylethyl)-6-piperidin-1-ylbenzo[de]isoquinoline-1,3-dione (PubChem CID 15374734) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-(2-phenylethyl)-6-piperidin-1-ylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(2-phenylethyl)-6-piperidin-1-ylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 15374734 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-(2-phenylethyl)-6-piperidin-1-ylbenzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3c(N4CCCCC4)ccc(c23)C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C25H24N2O2/c28-24-20-11-7-10-19-22(26-15-5-2-6-16-26)13-12-21(23(19)20)25(29)27(24)17-14-18-8-3-1-4-9-18/h1,3-4,7-13H,2,5-6,14-17H2 |
| InChIKey | MKDKLHIWZMIZBS-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|