C39H40N4O6 — CID 134276516
2-[[2-[[2-[6-(azocan-1-yl)-1,3-dioxobenzo[de]isoquinolin-2-yl]acetyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid (PubChem CID 134276516) has the molecular formula C39H40N4O6 and a molecular weight of 660.77 g/mol. Its IUPAC name is 2-[[2-[[2-[6-(azocan-1-yl)-1,3-dioxobenzo[de]isoquinolin-2-yl]acetyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[2-[6-(azocan-1-yl)-1,3-dioxobenzo[de]isoquinolin-2-yl]acetyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 134276516 |
| Molecular Formula | C39H40N4O6 |
| Molecular Weight | 660.77 g/mol |
| Exact Mass | 660.29 |
| IUPAC Name | 2-[[2-[[2-[6-(azocan-1-yl)-1,3-dioxobenzo[de]isoquinolin-2-yl]acetyl]amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(CN1C(=O)c2cccc3c(N4CCCCCCC4)ccc(c23)C1=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C39H40N4O6/c44-34(40-31(23-26-13-6-4-7-14-26)36(45)41-32(39(48)49)24-27-15-8-5-9-16-27)25-43-37(46)29-18-12-17-28-33(20-19-30(35(28)29)38(43)47)42-21-10-2-1-3-11-22-42/h4-9,12-20,31-32H,1-3,10-11,21-25H2,(H,40,44)(H,41,45)(H,48,49) |
| InChIKey | LIRXQGBRPGIOKT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.77 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|