C38H37N3O6 — CID 159874615
2-benzyl-5-[[2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)acetyl]amino]-4-oxo-6-phenylhexanoic acid (PubChem CID 159874615) has the molecular formula C38H37N3O6 and a molecular weight of 631.73 g/mol. Its IUPAC name is 2-benzyl-5-[[2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)acetyl]amino]-4-oxo-6-phenylhexanoic acid.
| Compound Name | 2-benzyl-5-[[2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)acetyl]amino]-4-oxo-6-phenylhexanoic acid |
|---|---|
| PubChem CID | 159874615 |
| Molecular Formula | C38H37N3O6 |
| Molecular Weight | 631.73 g/mol |
| Exact Mass | 631.27 |
| IUPAC Name | 2-benzyl-5-[[2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)acetyl]amino]-4-oxo-6-phenylhexanoic acid |
| SMILES | O=C(CN1C(=O)c2cccc3c(N4CCCCC4)ccc(c23)C1=O)NC(Cc1ccccc1)C(=O)CC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C38H37N3O6/c42-33(23-27(38(46)47)21-25-11-4-1-5-12-25)31(22-26-13-6-2-7-14-26)39-34(43)24-41-36(44)29-16-10-15-28-32(40-19-8-3-9-20-40)18-17-30(35(28)29)37(41)45/h1-2,4-7,10-18,27,31H,3,8-9,19-24H2,(H,39,43)(H,46,47) |
| InChIKey | NSSZJXVWUYNLDZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.73 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|