C26H22N2O7 — CID 158556128
5-[[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)acetyl]amino]-2-[(4-hydroxyphenyl)methyl]-4-oxopentanoic acid (PubChem CID 158556128) has the molecular formula C26H22N2O7 and a molecular weight of 474.47 g/mol. Its IUPAC name is 5-[[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)acetyl]amino]-2-[(4-hydroxyphenyl)methyl]-4-oxopentanoic acid.
| Compound Name | 5-[[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)acetyl]amino]-2-[(4-hydroxyphenyl)methyl]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 158556128 |
| Molecular Formula | C26H22N2O7 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 5-[[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)acetyl]amino]-2-[(4-hydroxyphenyl)methyl]-4-oxopentanoic acid |
| SMILES | O=C(CNC(=O)CN1C(=O)c2cccc3cccc(c23)C1=O)CC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C26H22N2O7/c29-18-9-7-15(8-10-18)11-17(26(34)35)12-19(30)13-27-22(31)14-28-24(32)20-5-1-3-16-4-2-6-21(23(16)20)25(28)33/h1-10,17,29H,11-14H2,(H,27,31)(H,34,35) |
| InChIKey | HQHXGDCXAXCFGK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|