C15H11NO5 — CID 66166093
3-(1,3-dioxobenzo[de]isoquinolin-2-yl)-2-hydroxypropanoic acid (PubChem CID 66166093) has the molecular formula C15H11NO5 and a molecular weight of 285.25 g/mol. Its IUPAC name is 3-(1,3-dioxobenzo[de]isoquinolin-2-yl)-2-hydroxypropanoic acid.
| Compound Name | 3-(1,3-dioxobenzo[de]isoquinolin-2-yl)-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 66166093 |
| Molecular Formula | C15H11NO5 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-(1,3-dioxobenzo[de]isoquinolin-2-yl)-2-hydroxypropanoic acid |
| SMILES | O=C(O)C(O)CN1C(=O)c2cccc3cccc(c23)C1=O |
| InChI | InChI=1S/C15H11NO5/c17-11(15(20)21)7-16-13(18)9-5-1-3-8-4-2-6-10(12(8)9)14(16)19/h1-6,11,17H,7H2,(H,20,21) |
| InChIKey | FOFYLMWLZBGOJE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|