C21H15NO4 — CID 10831354
3-(1,3-dioxoisoindol-2-yl)-2-naphthalen-1-ylpropanoic acid (PubChem CID 10831354) has the molecular formula C21H15NO4 and a molecular weight of 345.35 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-2-naphthalen-1-ylpropanoic acid.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-2-naphthalen-1-ylpropanoic acid |
|---|---|
| PubChem CID | 10831354 |
| Molecular Formula | C21H15NO4 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-2-naphthalen-1-ylpropanoic acid |
| SMILES | O=C(O)C(CN1C(=O)c2ccccc2C1=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H15NO4/c23-19-16-9-3-4-10-17(16)20(24)22(19)12-18(21(25)26)15-11-5-7-13-6-1-2-8-14(13)15/h1-11,18H,12H2,(H,25,26) |
| InChIKey | JWMLKRMLMDGOJY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|