C21H14ClNO3 — CID 10737457
3-(1,3-dioxoisoindol-2-yl)-2-naphthalen-1-ylpropanoyl chloride (PubChem CID 10737457) has the molecular formula C21H14ClNO3 and a molecular weight of 363.80 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-2-naphthalen-1-ylpropanoyl chloride.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-2-naphthalen-1-ylpropanoyl chloride |
|---|---|
| PubChem CID | 10737457 |
| Molecular Formula | C21H14ClNO3 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-2-naphthalen-1-ylpropanoyl chloride |
| SMILES | O=C(Cl)C(CN1C(=O)c2ccccc2C1=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H14ClNO3/c22-19(24)18(15-11-5-7-13-6-1-2-8-14(13)15)12-23-20(25)16-9-3-4-10-17(16)21(23)26/h1-11,18H,12H2 |
| InChIKey | VGMMRMFDLXRUDA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|