About 2-chloro-2-naphthalen-1-ylacetyl chloride;methane
2-chloro-2-naphthalen-1-ylacetyl chloride;methane (PubChem CID 174783201) has the molecular formula C13H12Cl2O
and a molecular weight of 255.14 g/mol. Its IUPAC name is 2-chloro-2-naphthalen-1-ylacetyl chloride;methane.
Molecular Properties
| Compound Name | 2-chloro-2-naphthalen-1-ylacetyl chloride;methane |
| PubChem CID | 174783201 |
| Molecular Formula | C13H12Cl2O |
| Molecular Weight | 255.14 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2-chloro-2-naphthalen-1-ylacetyl chloride;methane |
| SMILES | C.O=C(Cl)C(Cl)c1cccc2ccccc12 |
| InChI | InChI=1S/C12H8Cl2O.CH4/c13-11(12(14)15)10-7-3-5-8-4-1-2-6-9(8)10;/h1-7,11H;1H4 |
| InChIKey | JPCXACVAOPNDSM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.14 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-2-naphthalen-1-ylacetyl chloride;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-2-naphthalen-1-ylacetyl chloride;methane?
The IUPAC name of 2-chloro-2-naphthalen-1-ylacetyl chloride;methane (CID 174783201) is 2-chloro-2-naphthalen-1-ylacetyl chloride;methane.
What is the SMILES notation for 2-chloro-2-naphthalen-1-ylacetyl chloride;methane?
The canonical SMILES for 2-chloro-2-naphthalen-1-ylacetyl chloride;methane is C.O=C(Cl)C(Cl)c1cccc2ccccc12.
What is the InChIKey of 2-chloro-2-naphthalen-1-ylacetyl chloride;methane?
The InChIKey is JPCXACVAOPNDSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8Cl2O.CH4/c13-11(12(14)15)10-7-3-5-8-4-1-2-6-9(8)10;/h1-7,11H;1H4.
What are the key properties of 2-chloro-2-naphthalen-1-ylacetyl chloride;methane?
2-chloro-2-naphthalen-1-ylacetyl chloride;methane has a molecular weight of 255.14 g/mol, XLogP of 4.52, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-2-naphthalen-1-ylacetyl chloride;methane is sourced from PubChem (CID 174783201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).