C11H9NO5 — CID 67719573
(2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid (PubChem CID 67719573) has the molecular formula C11H9NO5 and a molecular weight of 235.20 g/mol. Its IUPAC name is (2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid.
| Compound Name | (2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 67719573 |
| Molecular Formula | C11H9NO5 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | (2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid |
| SMILES | O=C(O)[C@@H](O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H9NO5/c13-8(11(16)17)5-12-9(14)6-3-1-2-4-7(6)10(12)15/h1-4,8,13H,5H2,(H,16,17)/t8-/m0/s1 |
| InChIKey | FTYIPEUXWXPNBZ-QMMMGPOBSA-N |
| XLogP | -0.27 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|