(2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid

C11H9NO5 — CID 67719573

IUPAC(2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid
SMILESO=C(O)[C@@H](O)CN1C(=O)c2ccccc2C1=O
InChIInChI=1S/C11H9NO5/c13-8(11(16)17)5-12-9(14)6-3-1-2-4-7(6)10(12)15/h1-4,8,13H,5H2,(H,16,17)/t8-/m0/s1
InChIKeyFTYIPEUXWXPNBZ-QMMMGPOBSA-N
MW235.20 g/mol
LogP-0.27
Rot. Bonds3

About (2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid

(2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid (PubChem CID 67719573) has the molecular formula C11H9NO5 and a molecular weight of 235.20 g/mol. Its IUPAC name is (2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid.

Molecular Properties

Compound Name(2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid
PubChem CID67719573
Molecular FormulaC11H9NO5
Molecular Weight235.20 g/mol
Exact Mass235.05
IUPAC Name(2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid
SMILESO=C(O)[C@@H](O)CN1C(=O)c2ccccc2C1=O
InChIInChI=1S/C11H9NO5/c13-8(11(16)17)5-12-9(14)6-3-1-2-4-7(6)10(12)15/h1-4,8,13H,5H2,(H,16,17)/t8-/m0/s1
InChIKeyFTYIPEUXWXPNBZ-QMMMGPOBSA-N
XLogP-0.27
TPSA94.91 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.20
LogP ≤ 5-0.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze (2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid?
The IUPAC name of (2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid (CID 67719573) is (2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid.
What is the SMILES notation for (2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid?
The canonical SMILES for (2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid is O=C(O)[C@@H](O)CN1C(=O)c2ccccc2C1=O.
What is the InChIKey of (2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid?
The InChIKey is FTYIPEUXWXPNBZ-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H9NO5/c13-8(11(16)17)5-12-9(14)6-3-1-2-4-7(6)10(12)15/h1-4,8,13H,5H2,(H,16,17)/t8-/m0/s1.
What are the key properties of (2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid?
(2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid has a molecular weight of 235.20 g/mol, XLogP of -0.27, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropanoic acid is sourced from PubChem (CID 67719573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).