C14H15NO4 — CID 139039322
2-[(2S,3S)-2-hydroxy-3-methyl-4-oxopentyl]isoindole-1,3-dione (PubChem CID 139039322) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-[(2S,3S)-2-hydroxy-3-methyl-4-oxopentyl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,3S)-2-hydroxy-3-methyl-4-oxopentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139039322 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-[(2S,3S)-2-hydroxy-3-methyl-4-oxopentyl]isoindole-1,3-dione |
| SMILES | CC(=O)[C@@H](C)[C@H](O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H15NO4/c1-8(9(2)16)12(17)7-15-13(18)10-5-3-4-6-11(10)14(15)19/h3-6,8,12,17H,7H2,1-2H3/t8-,12-/m1/s1 |
| InChIKey | YBYADCJGAHWFFA-PRHODGIISA-N |
| XLogP | 0.87 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|