C13H13NO4 — CID 14714940
[(2R)-1-(1,3-dioxoisoindol-2-yl)propan-2-yl] acetate (PubChem CID 14714940) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is [(2R)-1-(1,3-dioxoisoindol-2-yl)propan-2-yl] acetate.
| Compound Name | [(2R)-1-(1,3-dioxoisoindol-2-yl)propan-2-yl] acetate |
|---|---|
| PubChem CID | 14714940 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | [(2R)-1-(1,3-dioxoisoindol-2-yl)propan-2-yl] acetate |
| SMILES | CC(=O)O[C@H](C)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H13NO4/c1-8(18-9(2)15)7-14-12(16)10-5-3-4-6-11(10)13(14)17/h3-6,8H,7H2,1-2H3/t8-/m1/s1 |
| InChIKey | PUHPHKCGNJLCTJ-MRVPVSSYSA-N |
| XLogP | 1.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|