C25H26N2O6 — CID 21472969
2-[2-[2-[2-(1,3-dioxoisoindol-2-yl)propoxy]propoxy]propyl]isoindole-1,3-dione (PubChem CID 21472969) has the molecular formula C25H26N2O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is 2-[2-[2-[2-(1,3-dioxoisoindol-2-yl)propoxy]propoxy]propyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-[2-(1,3-dioxoisoindol-2-yl)propoxy]propoxy]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 21472969 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2-[2-[2-[2-(1,3-dioxoisoindol-2-yl)propoxy]propoxy]propyl]isoindole-1,3-dione |
| SMILES | CC(COC(C)CN1C(=O)c2ccccc2C1=O)OCC(C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H26N2O6/c1-15(27-24(30)20-10-6-7-11-21(20)25(27)31)13-32-17(3)14-33-16(2)12-26-22(28)18-8-4-5-9-19(18)23(26)29/h4-11,15-17H,12-14H2,1-3H3 |
| InChIKey | LGSKVLYNUKHAGI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|