C21H18N2O4 — CID 100990759
2-[(2R,4R)-4-(1,3-dioxoisoindol-2-yl)pentan-2-yl]isoindole-1,3-dione (PubChem CID 100990759) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-[(2R,4R)-4-(1,3-dioxoisoindol-2-yl)pentan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R,4R)-4-(1,3-dioxoisoindol-2-yl)pentan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 100990759 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-[(2R,4R)-4-(1,3-dioxoisoindol-2-yl)pentan-2-yl]isoindole-1,3-dione |
| SMILES | C[C@H](C[C@@H](C)N1C(=O)c2ccccc2C1=O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H18N2O4/c1-12(22-18(24)14-7-3-4-8-15(14)19(22)25)11-13(2)23-20(26)16-9-5-6-10-17(16)21(23)27/h3-10,12-13H,11H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | GBYKKPFBINKJHS-CHWSQXEVSA-N |
| XLogP | 2.75 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|