C23H19NO2 — CID 14368628
2-[1-(4-phenylphenyl)propan-2-yl]isoindole-1,3-dione (PubChem CID 14368628) has the molecular formula C23H19NO2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-[1-(4-phenylphenyl)propan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[1-(4-phenylphenyl)propan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 14368628 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-[1-(4-phenylphenyl)propan-2-yl]isoindole-1,3-dione |
| SMILES | CC(Cc1ccc(-c2ccccc2)cc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H19NO2/c1-16(24-22(25)20-9-5-6-10-21(20)23(24)26)15-17-11-13-19(14-12-17)18-7-3-2-4-8-18/h2-14,16H,15H2,1H3 |
| InChIKey | USTOQZINZFKYRW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|