C21H19FN2O5 — CID 53215778
2-[3-(1,3-dioxoisoindol-2-yl)butanoylamino]-3-(4-fluorophenyl)propanoic acid (PubChem CID 53215778) has the molecular formula C21H19FN2O5 and a molecular weight of 398.39 g/mol. Its IUPAC name is 2-[3-(1,3-dioxoisoindol-2-yl)butanoylamino]-3-(4-fluorophenyl)propanoic acid.
| Compound Name | 2-[3-(1,3-dioxoisoindol-2-yl)butanoylamino]-3-(4-fluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 53215778 |
| Molecular Formula | C21H19FN2O5 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-[3-(1,3-dioxoisoindol-2-yl)butanoylamino]-3-(4-fluorophenyl)propanoic acid |
| SMILES | CC(CC(=O)NC(Cc1ccc(F)cc1)C(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H19FN2O5/c1-12(24-19(26)15-4-2-3-5-16(15)20(24)27)10-18(25)23-17(21(28)29)11-13-6-8-14(22)9-7-13/h2-9,12,17H,10-11H2,1H3,(H,23,25)(H,28,29) |
| InChIKey | HIFTZXZLKAXSPR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|