C30H36N2O6 — CID 159156750
1-(3,4-dimethoxyphenyl)propan-2-amine;2-[1-(3,4-dimethoxyphenyl)propan-2-yl]isoindole-1,3-dione (PubChem CID 159156750) has the molecular formula C30H36N2O6 and a molecular weight of 520.63 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)propan-2-amine;2-[1-(3,4-dimethoxyphenyl)propan-2-yl]isoindole-1,3-dione.
| Compound Name | 1-(3,4-dimethoxyphenyl)propan-2-amine;2-[1-(3,4-dimethoxyphenyl)propan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 159156750 |
| Molecular Formula | C30H36N2O6 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)propan-2-amine;2-[1-(3,4-dimethoxyphenyl)propan-2-yl]isoindole-1,3-dione |
| SMILES | COc1ccc(CC(C)N)cc1OC.COc1ccc(CC(C)N2C(=O)c3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/C19H19NO4.C11H17NO2/c1-12(10-13-8-9-16(23-2)17(11-13)24-3)20-18(21)14-6-4-5-7-15(14)19(20)22;1-8(12)6-9-4-5-10(13-2)11(7-9)14-3/h4-9,11-12H,10H2,1-3H3;4-5,7-8H,6,12H2,1-3H3 |
| InChIKey | KJZIWAUOBFQYOA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|