C43H44N2O9 — CID 70363596
2-[(4S,6S)-1,9-bis(3,4-dimethoxyphenyl)-6-(1,3-dioxoisoindol-2-yl)-2,8-dimethyl-5-oxononan-4-yl]isoindole-1,3-dione (PubChem CID 70363596) has the molecular formula C43H44N2O9 and a molecular weight of 732.83 g/mol. Its IUPAC name is 2-[(4S,6S)-1,9-bis(3,4-dimethoxyphenyl)-6-(1,3-dioxoisoindol-2-yl)-2,8-dimethyl-5-oxononan-4-yl]isoindole-1,3-dione.
| Compound Name | 2-[(4S,6S)-1,9-bis(3,4-dimethoxyphenyl)-6-(1,3-dioxoisoindol-2-yl)-2,8-dimethyl-5-oxononan-4-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70363596 |
| Molecular Formula | C43H44N2O9 |
| Molecular Weight | 732.83 g/mol |
| Exact Mass | 732.30 |
| IUPAC Name | 2-[(4S,6S)-1,9-bis(3,4-dimethoxyphenyl)-6-(1,3-dioxoisoindol-2-yl)-2,8-dimethyl-5-oxononan-4-yl]isoindole-1,3-dione |
| SMILES | COc1ccc(CC(C)C[C@@H](C(=O)[C@H](CC(C)Cc2ccc(OC)c(OC)c2)N2C(=O)c3ccccc3C2=O)N2C(=O)c3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/C43H44N2O9/c1-25(19-27-15-17-35(51-3)37(23-27)53-5)21-33(44-40(47)29-11-7-8-12-30(29)41(44)48)39(46)34(45-42(49)31-13-9-10-14-32(31)43(45)50)22-26(2)20-28-16-18-36(52-4)38(24-28)54-6/h7-18,23-26,33-34H,19-22H2,1-6H3/t25?,26?,33-,34-/m0/s1 |
| InChIKey | NJOZLGWYPUECEQ-GOIVSYHGSA-N |
| XLogP | 6.46 |
| TPSA | 128.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.83 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|