C18H15NO6 — CID 23966444
(1,3-dioxoisoindol-2-yl) 2-(3,4-dimethoxyphenyl)acetate (PubChem CID 23966444) has the molecular formula C18H15NO6 and a molecular weight of 341.32 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) 2-(3,4-dimethoxyphenyl)acetate.
| Compound Name | (1,3-dioxoisoindol-2-yl) 2-(3,4-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 23966444 |
| Molecular Formula | C18H15NO6 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) 2-(3,4-dimethoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)ON2C(=O)c3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/C18H15NO6/c1-23-14-8-7-11(9-15(14)24-2)10-16(20)25-19-17(21)12-5-3-4-6-13(12)18(19)22/h3-9H,10H2,1-2H3 |
| InChIKey | XLENQGDNYBOMEO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|