C49H40N2O9 — CID 70363603
2-[(2S,4S)-1,5-bis(3,4-dimethoxyphenyl)-4-(1,3-dioxoisoindol-2-yl)-3-oxo-1,5-diphenylpentan-2-yl]isoindole-1,3-dione (PubChem CID 70363603) has the molecular formula C49H40N2O9 and a molecular weight of 800.86 g/mol. Its IUPAC name is 2-[(2S,4S)-1,5-bis(3,4-dimethoxyphenyl)-4-(1,3-dioxoisoindol-2-yl)-3-oxo-1,5-diphenylpentan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,4S)-1,5-bis(3,4-dimethoxyphenyl)-4-(1,3-dioxoisoindol-2-yl)-3-oxo-1,5-diphenylpentan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70363603 |
| Molecular Formula | C49H40N2O9 |
| Molecular Weight | 800.86 g/mol |
| Exact Mass | 800.27 |
| IUPAC Name | 2-[(2S,4S)-1,5-bis(3,4-dimethoxyphenyl)-4-(1,3-dioxoisoindol-2-yl)-3-oxo-1,5-diphenylpentan-2-yl]isoindole-1,3-dione |
| SMILES | COc1ccc(C(c2ccccc2)[C@@H](C(=O)[C@H](C(c2ccccc2)c2ccc(OC)c(OC)c2)N2C(=O)c3ccccc3C2=O)N2C(=O)c3ccccc3C2=O)cc1OC |
| InChI | InChI=1S/C49H40N2O9/c1-57-37-25-23-31(27-39(37)59-3)41(29-15-7-5-8-16-29)43(50-46(53)33-19-11-12-20-34(33)47(50)54)45(52)44(51-48(55)35-21-13-14-22-36(35)49(51)56)42(30-17-9-6-10-18-30)32-24-26-38(58-2)40(28-32)60-4/h5-28,41-44H,1-4H3/t41?,42?,43-,44-/m0/s1 |
| InChIKey | APKFNZUSMKPXFU-HHRXABRNSA-N |
| XLogP | 7.58 |
| TPSA | 128.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.86 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|