C21H23NO5 — CID 141117216
2-[1-(3-ethoxy-4-methoxyphenyl)-3-hydroxybutyl]isoindole-1,3-dione (PubChem CID 141117216) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-[1-(3-ethoxy-4-methoxyphenyl)-3-hydroxybutyl]isoindole-1,3-dione.
| Compound Name | 2-[1-(3-ethoxy-4-methoxyphenyl)-3-hydroxybutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 141117216 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-[1-(3-ethoxy-4-methoxyphenyl)-3-hydroxybutyl]isoindole-1,3-dione |
| SMILES | CCOc1cc(C(CC(C)O)N2C(=O)c3ccccc3C2=O)ccc1OC |
| InChI | InChI=1S/C21H23NO5/c1-4-27-19-12-14(9-10-18(19)26-3)17(11-13(2)23)22-20(24)15-7-5-6-8-16(15)21(22)25/h5-10,12-13,17,23H,4,11H2,1-3H3 |
| InChIKey | AIFYGXLVOOVOFQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|