C21H22N3O6+ — CID 142801432
[2-[2-cyano-1-(3-ethoxy-4-methoxyphenyl)ethyl]-1,3-dioxoisoindol-4-yl]-oxoazanium;methanol (PubChem CID 142801432) has the molecular formula C21H22N3O6+ and a molecular weight of 412.42 g/mol. Its IUPAC name is [2-[2-cyano-1-(3-ethoxy-4-methoxyphenyl)ethyl]-1,3-dioxoisoindol-4-yl]-oxoazanium;methanol.
| Compound Name | [2-[2-cyano-1-(3-ethoxy-4-methoxyphenyl)ethyl]-1,3-dioxoisoindol-4-yl]-oxoazanium;methanol |
|---|---|
| PubChem CID | 142801432 |
| Molecular Formula | C21H22N3O6+ |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | [2-[2-cyano-1-(3-ethoxy-4-methoxyphenyl)ethyl]-1,3-dioxoisoindol-4-yl]-oxoazanium;methanol |
| SMILES | CCOc1cc(C(CC#N)N2C(=O)c3cccc([NH+]=O)c3C2=O)ccc1OC.CO |
| InChI | InChI=1S/C20H17N3O5.CH4O/c1-3-28-17-11-12(7-8-16(17)27-2)15(9-10-21)23-19(24)13-5-4-6-14(22-26)18(13)20(23)25;1-2/h4-8,11,15H,3,9H2,1-2H3;2H,1H3/p+1 |
| InChIKey | WHRNOEMVXHIZHC-UHFFFAOYSA-O |
| XLogP | 1.43 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|