C21H23NO6S — CID 19361840
2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-4-methylisoindole-1,3-dione (PubChem CID 19361840) has the molecular formula C21H23NO6S and a molecular weight of 417.48 g/mol. Its IUPAC name is 2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-4-methylisoindole-1,3-dione.
| Compound Name | 2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-4-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 19361840 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-4-methylisoindole-1,3-dione |
| SMILES | CCOc1cc(C(CS(C)(=O)=O)N2C(=O)c3cccc(C)c3C2=O)ccc1OC |
| InChI | InChI=1S/C21H23NO6S/c1-5-28-18-11-14(9-10-17(18)27-3)16(12-29(4,25)26)22-20(23)15-8-6-7-13(2)19(15)21(22)24/h6-11,16H,5,12H2,1-4H3 |
| InChIKey | VPAAJUYHFYEOJO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|