C22H23ClN2O7S — CID 18758373
2-chloro-N-[2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]acetamide (PubChem CID 18758373) has the molecular formula C22H23ClN2O7S and a molecular weight of 494.95 g/mol. Its IUPAC name is 2-chloro-N-[2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]acetamide.
| Compound Name | 2-chloro-N-[2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]acetamide |
|---|---|
| PubChem CID | 18758373 |
| Molecular Formula | C22H23ClN2O7S |
| Molecular Weight | 494.95 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 2-chloro-N-[2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]acetamide |
| SMILES | CCOc1cc(C(CS(C)(=O)=O)N2C(=O)c3cccc(NC(=O)CCl)c3C2=O)ccc1OC |
| InChI | InChI=1S/C22H23ClN2O7S/c1-4-32-18-10-13(8-9-17(18)31-2)16(12-33(3,29)30)25-21(27)14-6-5-7-15(20(14)22(25)28)24-19(26)11-23/h5-10,16H,4,11-12H2,1-3H3,(H,24,26) |
| InChIKey | KVBKXXOHQDLRLG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.95 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|