C23H23ClN2O6 — CID 66718506
2-chloro-N-[2-[(1R)-1-(3-ethoxy-4-methoxyphenyl)-3-oxobutyl]-1,3-dioxoisoindol-4-yl]acetamide (PubChem CID 66718506) has the molecular formula C23H23ClN2O6 and a molecular weight of 458.90 g/mol. Its IUPAC name is 2-chloro-N-[2-[(1R)-1-(3-ethoxy-4-methoxyphenyl)-3-oxobutyl]-1,3-dioxoisoindol-4-yl]acetamide.
| Compound Name | 2-chloro-N-[2-[(1R)-1-(3-ethoxy-4-methoxyphenyl)-3-oxobutyl]-1,3-dioxoisoindol-4-yl]acetamide |
|---|---|
| PubChem CID | 66718506 |
| Molecular Formula | C23H23ClN2O6 |
| Molecular Weight | 458.90 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 2-chloro-N-[2-[(1R)-1-(3-ethoxy-4-methoxyphenyl)-3-oxobutyl]-1,3-dioxoisoindol-4-yl]acetamide |
| SMILES | CCOc1cc([C@@H](CC(C)=O)N2C(=O)c3cccc(NC(=O)CCl)c3C2=O)ccc1OC |
| InChI | InChI=1S/C23H23ClN2O6/c1-4-32-19-11-14(8-9-18(19)31-3)17(10-13(2)27)26-22(29)15-6-5-7-16(21(15)23(26)30)25-20(28)12-24/h5-9,11,17H,4,10,12H2,1-3H3,(H,25,28)/t17-/m1/s1 |
| InChIKey | RREPAJHHRAPCQP-QGZVFWFLSA-N |
| XLogP | 3.59 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.90 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|