C21H23N3O6 — CID 142645659
3-(3-ethoxy-4-methoxyphenyl)-N-hydroxy-3-[4-(methylamino)-1,3-dioxoisoindol-2-yl]propanamide (PubChem CID 142645659) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is 3-(3-ethoxy-4-methoxyphenyl)-N-hydroxy-3-[4-(methylamino)-1,3-dioxoisoindol-2-yl]propanamide.
| Compound Name | 3-(3-ethoxy-4-methoxyphenyl)-N-hydroxy-3-[4-(methylamino)-1,3-dioxoisoindol-2-yl]propanamide |
|---|---|
| PubChem CID | 142645659 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 3-(3-ethoxy-4-methoxyphenyl)-N-hydroxy-3-[4-(methylamino)-1,3-dioxoisoindol-2-yl]propanamide |
| SMILES | CCOc1cc(C(CC(=O)NO)N2C(=O)c3cccc(NC)c3C2=O)ccc1OC |
| InChI | InChI=1S/C21H23N3O6/c1-4-30-17-10-12(8-9-16(17)29-3)15(11-18(25)23-28)24-20(26)13-6-5-7-14(22-2)19(13)21(24)27/h5-10,15,22,28H,4,11H2,1-3H3,(H,23,25) |
| InChIKey | BCXVDMUMVJESCB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|