C21H22N2O6 — CID 146197051
methyl (3R)-3-(4-amino-1,3-dioxoisoindol-2-yl)-3-(3-ethoxy-4-methoxyphenyl)propanoate (PubChem CID 146197051) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is methyl (3R)-3-(4-amino-1,3-dioxoisoindol-2-yl)-3-(3-ethoxy-4-methoxyphenyl)propanoate.
| Compound Name | methyl (3R)-3-(4-amino-1,3-dioxoisoindol-2-yl)-3-(3-ethoxy-4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 146197051 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | methyl (3R)-3-(4-amino-1,3-dioxoisoindol-2-yl)-3-(3-ethoxy-4-methoxyphenyl)propanoate |
| SMILES | CCOc1cc([C@@H](CC(=O)OC)N2C(=O)c3cccc(N)c3C2=O)ccc1OC |
| InChI | InChI=1S/C21H22N2O6/c1-4-29-17-10-12(8-9-16(17)27-2)15(11-18(24)28-3)23-20(25)13-6-5-7-14(22)19(13)21(23)26/h5-10,15H,4,11,22H2,1-3H3/t15-/m1/s1 |
| InChIKey | IOMFLKBAUSLEFU-OAHLLOKOSA-N |
| XLogP | 2.58 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|