C22H24N2O6 — CID 151632184
methyl 3-(3-ethoxy-4-methoxyphenyl)-3-[4-(methylamino)-1,3-dioxoisoindol-2-yl]propanoate (PubChem CID 151632184) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is methyl 3-(3-ethoxy-4-methoxyphenyl)-3-[4-(methylamino)-1,3-dioxoisoindol-2-yl]propanoate.
| Compound Name | methyl 3-(3-ethoxy-4-methoxyphenyl)-3-[4-(methylamino)-1,3-dioxoisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 151632184 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | methyl 3-(3-ethoxy-4-methoxyphenyl)-3-[4-(methylamino)-1,3-dioxoisoindol-2-yl]propanoate |
| SMILES | CCOc1cc(C(CC(=O)OC)N2C(=O)c3cccc(NC)c3C2=O)ccc1OC |
| InChI | InChI=1S/C22H24N2O6/c1-5-30-18-11-13(9-10-17(18)28-3)16(12-19(25)29-4)24-21(26)14-7-6-8-15(23-2)20(14)22(24)27/h6-11,16,23H,5,12H2,1-4H3 |
| InChIKey | QQTFCNGEPWJHLG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|