C40H40N4O12 — CID 162114857
3-(1,3-dioxoisoindol-2-yl)-3-(3-ethoxy-4-methoxyphenyl)-N-hydroxypropanamide (PubChem CID 162114857) has the molecular formula C40H40N4O12 and a molecular weight of 768.78 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-3-(3-ethoxy-4-methoxyphenyl)-N-hydroxypropanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-3-(3-ethoxy-4-methoxyphenyl)-N-hydroxypropanamide |
|---|---|
| PubChem CID | 162114857 |
| Molecular Formula | C40H40N4O12 |
| Molecular Weight | 768.78 g/mol |
| Exact Mass | 768.26 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-3-(3-ethoxy-4-methoxyphenyl)-N-hydroxypropanamide |
| SMILES | CCOc1cc(C(CC(=O)NO)N2C(=O)c3ccccc3C2=O)ccc1OC.CCOc1cc(C(CC(=O)NO)N2C(=O)c3ccccc3C2=O)ccc1OC |
| InChI | InChI=1S/2C20H20N2O6/c2*1-3-28-17-10-12(8-9-16(17)27-2)15(11-18(23)21-26)22-19(24)13-6-4-5-7-14(13)20(22)25/h2*4-10,15,26H,3,11H2,1-2H3,(H,21,23) |
| InChIKey | ZGQADDFJRHDNQV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 210.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.78 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|