C21H22ClN3O6 — CID 173103087
7-chloro-2-[1-(3-ethoxy-4-methoxyphenyl)-3-(hydroxyamino)-3-oxopropyl]-3-oxo-1H-isoindole-1-carboxamide (PubChem CID 173103087) has the molecular formula C21H22ClN3O6 and a molecular weight of 447.88 g/mol. Its IUPAC name is 7-chloro-2-[1-(3-ethoxy-4-methoxyphenyl)-3-(hydroxyamino)-3-oxopropyl]-3-oxo-1H-isoindole-1-carboxamide.
| Compound Name | 7-chloro-2-[1-(3-ethoxy-4-methoxyphenyl)-3-(hydroxyamino)-3-oxopropyl]-3-oxo-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 173103087 |
| Molecular Formula | C21H22ClN3O6 |
| Molecular Weight | 447.88 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 7-chloro-2-[1-(3-ethoxy-4-methoxyphenyl)-3-(hydroxyamino)-3-oxopropyl]-3-oxo-1H-isoindole-1-carboxamide |
| SMILES | CCOc1cc(C(CC(=O)NO)N2C(=O)c3cccc(Cl)c3C2C(N)=O)ccc1OC |
| InChI | InChI=1S/C21H22ClN3O6/c1-3-31-16-9-11(7-8-15(16)30-2)14(10-17(26)24-29)25-19(20(23)27)18-12(21(25)28)5-4-6-13(18)22/h4-9,14,19,29H,3,10H2,1-2H3,(H2,23,27)(H,24,26) |
| InChIKey | CWEQRPXFCBYOHR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.88 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|