C23H24N2O6 — CID 123222376
2-[2-[1-(3-ethoxy-4-methoxyphenyl)-3-oxobutyl]-1,3-dioxoisoindol-4-yl]acetamide (PubChem CID 123222376) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is 2-[2-[1-(3-ethoxy-4-methoxyphenyl)-3-oxobutyl]-1,3-dioxoisoindol-4-yl]acetamide.
| Compound Name | 2-[2-[1-(3-ethoxy-4-methoxyphenyl)-3-oxobutyl]-1,3-dioxoisoindol-4-yl]acetamide |
|---|---|
| PubChem CID | 123222376 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-[2-[1-(3-ethoxy-4-methoxyphenyl)-3-oxobutyl]-1,3-dioxoisoindol-4-yl]acetamide |
| SMILES | CCOc1cc(C(CC(C)=O)N2C(=O)c3cccc(CC(N)=O)c3C2=O)ccc1OC |
| InChI | InChI=1S/C23H24N2O6/c1-4-31-19-11-14(8-9-18(19)30-3)17(10-13(2)26)25-22(28)16-7-5-6-15(12-20(24)27)21(16)23(25)29/h5-9,11,17H,4,10,12H2,1-3H3,(H2,24,27) |
| InChIKey | UZOSIYQXJULQGN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|