C21H25ClN2O6S — CID 11669969
4-(aminomethyl)-2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]isoindole-1,3-dione;hydrochloride (PubChem CID 11669969) has the molecular formula C21H25ClN2O6S and a molecular weight of 468.96 g/mol. Its IUPAC name is 4-(aminomethyl)-2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]isoindole-1,3-dione;hydrochloride.
| Compound Name | 4-(aminomethyl)-2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 11669969 |
| Molecular Formula | C21H25ClN2O6S |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 4-(aminomethyl)-2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]isoindole-1,3-dione;hydrochloride |
| SMILES | CCOc1cc(C(CS(C)(=O)=O)N2C(=O)c3cccc(CN)c3C2=O)ccc1OC.Cl |
| InChI | InChI=1S/C21H24N2O6S.ClH/c1-4-29-18-10-13(8-9-17(18)28-2)16(12-30(3,26)27)23-20(24)15-7-5-6-14(11-22)19(15)21(23)25;/h5-10,16H,4,11-12,22H2,1-3H3;1H |
| InChIKey | GQFMVEASNXTCHG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|