C20H21FN2O6S — CID 146403099
4-amino-2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-5-fluoroisoindole-1,3-dione (PubChem CID 146403099) has the molecular formula C20H21FN2O6S and a molecular weight of 436.46 g/mol. Its IUPAC name is 4-amino-2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-5-fluoroisoindole-1,3-dione.
| Compound Name | 4-amino-2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-5-fluoroisoindole-1,3-dione |
|---|---|
| PubChem CID | 146403099 |
| Molecular Formula | C20H21FN2O6S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 4-amino-2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-5-fluoroisoindole-1,3-dione |
| SMILES | CCOc1cc(C(CS(C)(=O)=O)N2C(=O)c3ccc(F)c(N)c3C2=O)ccc1OC |
| InChI | InChI=1S/C20H21FN2O6S/c1-4-29-16-9-11(5-8-15(16)28-2)14(10-30(3,26)27)23-19(24)12-6-7-13(21)18(22)17(12)20(23)25/h5-9,14H,4,10,22H2,1-3H3 |
| InChIKey | JOWRLESWLFPPBM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|