C21H23N3O7S — CID 146403142
N-[2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxopyrrolo[3,4-c]pyridin-4-yl]acetamide (PubChem CID 146403142) has the molecular formula C21H23N3O7S and a molecular weight of 461.50 g/mol. Its IUPAC name is N-[2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxopyrrolo[3,4-c]pyridin-4-yl]acetamide.
| Compound Name | N-[2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxopyrrolo[3,4-c]pyridin-4-yl]acetamide |
|---|---|
| PubChem CID | 146403142 |
| Molecular Formula | C21H23N3O7S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | N-[2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxopyrrolo[3,4-c]pyridin-4-yl]acetamide |
| SMILES | CCOc1cc(C(CS(C)(=O)=O)N2C(=O)c3ccnc(NC(C)=O)c3C2=O)ccc1OC |
| InChI | InChI=1S/C21H23N3O7S/c1-5-31-17-10-13(6-7-16(17)30-3)15(11-32(4,28)29)24-20(26)14-8-9-22-19(23-12(2)25)18(14)21(24)27/h6-10,15H,5,11H2,1-4H3,(H,22,23,25) |
| InChIKey | ANFAQBPXQQMWDB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 131.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|