C24H29N3O8S — CID 57406307
1-[2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]-3-(2-methoxyethyl)urea (PubChem CID 57406307) has the molecular formula C24H29N3O8S and a molecular weight of 519.58 g/mol. Its IUPAC name is 1-[2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 57406307 |
| Molecular Formula | C24H29N3O8S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 1-[2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-1,3-dioxoisoindol-4-yl]-3-(2-methoxyethyl)urea |
| SMILES | CCOc1cc(C(CS(C)(=O)=O)N2C(=O)c3cccc(NC(=O)NCCOC)c3C2=O)ccc1OC |
| InChI | InChI=1S/C24H29N3O8S/c1-5-35-20-13-15(9-10-19(20)34-3)18(14-36(4,31)32)27-22(28)16-7-6-8-17(21(16)23(27)29)26-24(30)25-11-12-33-2/h6-10,13,18H,5,11-12,14H2,1-4H3,(H2,25,26,30) |
| InChIKey | AELAJQSAJOPYEU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|