C25H26N2O6S — CID 11511375
2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-4-(pyrrol-1-ylmethyl)isoindole-1,3-dione (PubChem CID 11511375) has the molecular formula C25H26N2O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is 2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-4-(pyrrol-1-ylmethyl)isoindole-1,3-dione.
| Compound Name | 2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-4-(pyrrol-1-ylmethyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 11511375 |
| Molecular Formula | C25H26N2O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]-4-(pyrrol-1-ylmethyl)isoindole-1,3-dione |
| SMILES | CCOc1cc(C(CS(C)(=O)=O)N2C(=O)c3cccc(Cn4cccc4)c3C2=O)ccc1OC |
| InChI | InChI=1S/C25H26N2O6S/c1-4-33-22-14-17(10-11-21(22)32-2)20(16-34(3,30)31)27-24(28)19-9-7-8-18(23(19)25(27)29)15-26-12-5-6-13-26/h5-14,20H,4,15-16H2,1-3H3 |
| InChIKey | CHSWRZOPSOZMBD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|