C18H20N2O6S2 — CID 137355635
3-amino-5-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]thieno[2,3-c]pyrrole-4,6-dione (PubChem CID 137355635) has the molecular formula C18H20N2O6S2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-amino-5-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]thieno[2,3-c]pyrrole-4,6-dione.
| Compound Name | 3-amino-5-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]thieno[2,3-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 137355635 |
| Molecular Formula | C18H20N2O6S2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 3-amino-5-[(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]thieno[2,3-c]pyrrole-4,6-dione |
| SMILES | CCOc1cc([C@@H](CS(C)(=O)=O)N2C(=O)c3scc(N)c3C2=O)ccc1OC |
| InChI | InChI=1S/C18H20N2O6S2/c1-4-26-14-7-10(5-6-13(14)25-2)12(9-28(3,23)24)20-17(21)15-11(19)8-27-16(15)18(20)22/h5-8,12H,4,9,19H2,1-3H3/t12-/m1/s1 |
| InChIKey | CYSBHXBDEZNAOW-GFCCVEGCSA-N |
| XLogP | 2.12 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|