C20H22N2O6S2 — CID 156754226
3-amino-5-[(1S)-2-cyclopropylsulfonyl-1-(3-ethoxy-4-methoxyphenyl)ethyl]thieno[3,4-c]pyrrole-4,6-dione (PubChem CID 156754226) has the molecular formula C20H22N2O6S2 and a molecular weight of 450.54 g/mol. Its IUPAC name is 3-amino-5-[(1S)-2-cyclopropylsulfonyl-1-(3-ethoxy-4-methoxyphenyl)ethyl]thieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 3-amino-5-[(1S)-2-cyclopropylsulfonyl-1-(3-ethoxy-4-methoxyphenyl)ethyl]thieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 156754226 |
| Molecular Formula | C20H22N2O6S2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 3-amino-5-[(1S)-2-cyclopropylsulfonyl-1-(3-ethoxy-4-methoxyphenyl)ethyl]thieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CCOc1cc([C@@H](CS(=O)(=O)C2CC2)N2C(=O)c3csc(N)c3C2=O)ccc1OC |
| InChI | InChI=1S/C20H22N2O6S2/c1-3-28-16-8-11(4-7-15(16)27-2)14(10-30(25,26)12-5-6-12)22-19(23)13-9-29-18(21)17(13)20(22)24/h4,7-9,12,14H,3,5-6,10,21H2,1-2H3/t14-/m1/s1 |
| InChIKey | FPLUEUYIXRBCFH-CQSZACIVSA-N |
| XLogP | 2.65 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|