C21H25N3O7S2 — CID 137355586
N-[5-[(1S)-2-(dimethylsulfamoyl)-1-(3-ethoxy-4-methoxyphenyl)ethyl]-4,6-dioxothieno[3,4-c]pyrrol-3-yl]acetamide (PubChem CID 137355586) has the molecular formula C21H25N3O7S2 and a molecular weight of 495.58 g/mol. Its IUPAC name is N-[5-[(1S)-2-(dimethylsulfamoyl)-1-(3-ethoxy-4-methoxyphenyl)ethyl]-4,6-dioxothieno[3,4-c]pyrrol-3-yl]acetamide.
| Compound Name | N-[5-[(1S)-2-(dimethylsulfamoyl)-1-(3-ethoxy-4-methoxyphenyl)ethyl]-4,6-dioxothieno[3,4-c]pyrrol-3-yl]acetamide |
|---|---|
| PubChem CID | 137355586 |
| Molecular Formula | C21H25N3O7S2 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | N-[5-[(1S)-2-(dimethylsulfamoyl)-1-(3-ethoxy-4-methoxyphenyl)ethyl]-4,6-dioxothieno[3,4-c]pyrrol-3-yl]acetamide |
| SMILES | CCOc1cc([C@@H](CS(=O)(=O)N(C)C)N2C(=O)c3csc(NC(C)=O)c3C2=O)ccc1OC |
| InChI | InChI=1S/C21H25N3O7S2/c1-6-31-17-9-13(7-8-16(17)30-5)15(11-33(28,29)23(3)4)24-20(26)14-10-32-19(22-12(2)25)18(14)21(24)27/h7-10,15H,6,11H2,1-5H3,(H,22,25)/t15-/m1/s1 |
| InChIKey | HVXKIHQUPBEPJC-OAHLLOKOSA-N |
| XLogP | 2.34 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|