C20H18F3N2O7S2- — CID 146459123
3-(3-acetamido-4,6-dioxothieno[3,4-c]pyrrol-5-yl)-3-[3-ethoxy-4-(trifluoromethoxy)phenyl]propane-1-sulfinate (PubChem CID 146459123) has the molecular formula C20H18F3N2O7S2- and a molecular weight of 519.50 g/mol. Its IUPAC name is 3-(3-acetamido-4,6-dioxothieno[3,4-c]pyrrol-5-yl)-3-[3-ethoxy-4-(trifluoromethoxy)phenyl]propane-1-sulfinate.
| Compound Name | 3-(3-acetamido-4,6-dioxothieno[3,4-c]pyrrol-5-yl)-3-[3-ethoxy-4-(trifluoromethoxy)phenyl]propane-1-sulfinate |
|---|---|
| PubChem CID | 146459123 |
| Molecular Formula | C20H18F3N2O7S2- |
| Molecular Weight | 519.50 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | 3-(3-acetamido-4,6-dioxothieno[3,4-c]pyrrol-5-yl)-3-[3-ethoxy-4-(trifluoromethoxy)phenyl]propane-1-sulfinate |
| SMILES | CCOc1cc(C(CCS(=O)[O-])N2C(=O)c3csc(NC(C)=O)c3C2=O)ccc1OC(F)(F)F |
| InChI | InChI=1S/C20H19F3N2O7S2/c1-3-31-15-8-11(4-5-14(15)32-20(21,22)23)13(6-7-34(29)30)25-18(27)12-9-33-17(24-10(2)26)16(12)19(25)28/h4-5,8-9,13H,3,6-7H2,1-2H3,(H,24,26)(H,29,30)/p-1 |
| InChIKey | WLGJAIAGWIGZPS-UHFFFAOYSA-M |
| XLogP | 3.61 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|