C25H30N3O7S- — CID 135370014
3-[4-[3-(dimethylamino)propanoylamino]-1,3-dioxoisoindol-2-yl]-3-(3-ethoxy-4-methoxyphenyl)propane-1-sulfinate (PubChem CID 135370014) has the molecular formula C25H30N3O7S- and a molecular weight of 516.60 g/mol. Its IUPAC name is 3-[4-[3-(dimethylamino)propanoylamino]-1,3-dioxoisoindol-2-yl]-3-(3-ethoxy-4-methoxyphenyl)propane-1-sulfinate.
| Compound Name | 3-[4-[3-(dimethylamino)propanoylamino]-1,3-dioxoisoindol-2-yl]-3-(3-ethoxy-4-methoxyphenyl)propane-1-sulfinate |
|---|---|
| PubChem CID | 135370014 |
| Molecular Formula | C25H30N3O7S- |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | 3-[4-[3-(dimethylamino)propanoylamino]-1,3-dioxoisoindol-2-yl]-3-(3-ethoxy-4-methoxyphenyl)propane-1-sulfinate |
| SMILES | CCOc1cc(C(CCS(=O)[O-])N2C(=O)c3cccc(NC(=O)CCN(C)C)c3C2=O)ccc1OC |
| InChI | InChI=1S/C25H31N3O7S/c1-5-35-21-15-16(9-10-20(21)34-4)19(12-14-36(32)33)28-24(30)17-7-6-8-18(23(17)25(28)31)26-22(29)11-13-27(2)3/h6-10,15,19H,5,11-14H2,1-4H3,(H,26,29)(H,32,33)/p-1 |
| InChIKey | UYDPBTBDZWWLIX-UHFFFAOYSA-M |
| XLogP | 2.59 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|