C23H26N3O7S- — CID 174686421
3-(3,4-dimethoxyphenyl)-3-[4-[[2-(dimethylamino)acetyl]amino]-1,3-dioxoisoindol-2-yl]propane-1-sulfinate (PubChem CID 174686421) has the molecular formula C23H26N3O7S- and a molecular weight of 488.54 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-3-[4-[[2-(dimethylamino)acetyl]amino]-1,3-dioxoisoindol-2-yl]propane-1-sulfinate.
| Compound Name | 3-(3,4-dimethoxyphenyl)-3-[4-[[2-(dimethylamino)acetyl]amino]-1,3-dioxoisoindol-2-yl]propane-1-sulfinate |
|---|---|
| PubChem CID | 174686421 |
| Molecular Formula | C23H26N3O7S- |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-3-[4-[[2-(dimethylamino)acetyl]amino]-1,3-dioxoisoindol-2-yl]propane-1-sulfinate |
| SMILES | COc1ccc(C(CCS(=O)[O-])N2C(=O)c3cccc(NC(=O)CN(C)C)c3C2=O)cc1OC |
| InChI | InChI=1S/C23H27N3O7S/c1-25(2)13-20(27)24-16-7-5-6-15-21(16)23(29)26(22(15)28)17(10-11-34(30)31)14-8-9-18(32-3)19(12-14)33-4/h5-9,12,17H,10-11,13H2,1-4H3,(H,24,27)(H,30,31)/p-1 |
| InChIKey | WMASJHOYPXJIDT-UHFFFAOYSA-M |
| XLogP | 1.81 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|