C13H15N3O4S — CID 166810201
2-(dimethylamino)-N-(2-methylsulfinyl-1,3-dioxoisoindol-4-yl)acetamide (PubChem CID 166810201) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is 2-(dimethylamino)-N-(2-methylsulfinyl-1,3-dioxoisoindol-4-yl)acetamide.
| Compound Name | 2-(dimethylamino)-N-(2-methylsulfinyl-1,3-dioxoisoindol-4-yl)acetamide |
|---|---|
| PubChem CID | 166810201 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2-(dimethylamino)-N-(2-methylsulfinyl-1,3-dioxoisoindol-4-yl)acetamide |
| SMILES | CN(C)CC(=O)Nc1cccc2c1C(=O)N(S(C)=O)C2=O |
| InChI | InChI=1S/C13H15N3O4S/c1-15(2)7-10(17)14-9-6-4-5-8-11(9)13(19)16(12(8)18)21(3)20/h4-6H,7H2,1-3H3,(H,14,17) |
| InChIKey | WXZDEUVEVSLESH-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|