C22H24N4O6 — CID 70800134
2-(dimethylamino)-N-[5-[[2-(dimethylamino)acetyl]amino]-4,8-dihydroxy-9,10-dioxoanthracen-1-yl]acetamide (PubChem CID 70800134) has the molecular formula C22H24N4O6 and a molecular weight of 440.46 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[5-[[2-(dimethylamino)acetyl]amino]-4,8-dihydroxy-9,10-dioxoanthracen-1-yl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[5-[[2-(dimethylamino)acetyl]amino]-4,8-dihydroxy-9,10-dioxoanthracen-1-yl]acetamide |
|---|---|
| PubChem CID | 70800134 |
| Molecular Formula | C22H24N4O6 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 2-(dimethylamino)-N-[5-[[2-(dimethylamino)acetyl]amino]-4,8-dihydroxy-9,10-dioxoanthracen-1-yl]acetamide |
| SMILES | CN(C)CC(=O)Nc1ccc(O)c2c1C(=O)c1c(O)ccc(NC(=O)CN(C)C)c1C2=O |
| InChI | InChI=1S/C22H24N4O6/c1-25(2)9-15(29)23-11-5-7-13(27)19-17(11)21(31)20-14(28)8-6-12(18(20)22(19)32)24-16(30)10-26(3)4/h5-8,27-28H,9-10H2,1-4H3,(H,23,29)(H,24,30) |
| InChIKey | IPZPIOBFPYDPPN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|