C30H22N2O8 — CID 154128556
2-(2,5-dihydroxyphenyl)-N-[4-[[2-(2,5-dihydroxyphenyl)acetyl]amino]-9,10-dioxoanthracen-1-yl]acetamide (PubChem CID 154128556) has the molecular formula C30H22N2O8 and a molecular weight of 538.51 g/mol. Its IUPAC name is 2-(2,5-dihydroxyphenyl)-N-[4-[[2-(2,5-dihydroxyphenyl)acetyl]amino]-9,10-dioxoanthracen-1-yl]acetamide.
| Compound Name | 2-(2,5-dihydroxyphenyl)-N-[4-[[2-(2,5-dihydroxyphenyl)acetyl]amino]-9,10-dioxoanthracen-1-yl]acetamide |
|---|---|
| PubChem CID | 154128556 |
| Molecular Formula | C30H22N2O8 |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 2-(2,5-dihydroxyphenyl)-N-[4-[[2-(2,5-dihydroxyphenyl)acetyl]amino]-9,10-dioxoanthracen-1-yl]acetamide |
| SMILES | O=C(Cc1cc(O)ccc1O)Nc1ccc(NC(=O)Cc2cc(O)ccc2O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C30H22N2O8/c33-17-5-9-23(35)15(11-17)13-25(37)31-21-7-8-22(32-26(38)14-16-12-18(34)6-10-24(16)36)28-27(21)29(39)19-3-1-2-4-20(19)30(28)40/h1-12,33-36H,13-14H2,(H,31,37)(H,32,38) |
| InChIKey | TXNVBWIDCSIYEC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 173.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|