C14H13NO5 — CID 131978402
2-(2,4-dihydroxyphenyl)-N-(2,5-dihydroxyphenyl)acetamide (PubChem CID 131978402) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is 2-(2,4-dihydroxyphenyl)-N-(2,5-dihydroxyphenyl)acetamide.
| Compound Name | 2-(2,4-dihydroxyphenyl)-N-(2,5-dihydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 131978402 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-(2,4-dihydroxyphenyl)-N-(2,5-dihydroxyphenyl)acetamide |
| SMILES | O=C(Cc1ccc(O)cc1O)Nc1cc(O)ccc1O |
| InChI | InChI=1S/C14H13NO5/c16-9-3-4-12(18)11(6-9)15-14(20)5-8-1-2-10(17)7-13(8)19/h1-4,6-7,16-19H,5H2,(H,15,20) |
| InChIKey | PXRDNFCLZVQBRF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|