C14H12F2N2O2 — CID 107697659
N-(2-amino-4-hydroxyphenyl)-2-(2,4-difluorophenyl)acetamide (PubChem CID 107697659) has the molecular formula C14H12F2N2O2 and a molecular weight of 278.26 g/mol. Its IUPAC name is N-(2-amino-4-hydroxyphenyl)-2-(2,4-difluorophenyl)acetamide.
| Compound Name | N-(2-amino-4-hydroxyphenyl)-2-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 107697659 |
| Molecular Formula | C14H12F2N2O2 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-(2-amino-4-hydroxyphenyl)-2-(2,4-difluorophenyl)acetamide |
| SMILES | Nc1cc(O)ccc1NC(=O)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C14H12F2N2O2/c15-9-2-1-8(11(16)6-9)5-14(20)18-13-4-3-10(19)7-12(13)17/h1-4,6-7,19H,5,17H2,(H,18,20) |
| InChIKey | JCQFTZBFWQSFAV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|